C21H19F3N2O2 — CID 97082963
(3R)-1-cyclopropyl-5-oxo-N-[4-phenyl-3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 97082963) has the molecular formula C21H19F3N2O2 and a molecular weight of 388.39 g/mol. Its IUPAC name is (3R)-1-cyclopropyl-5-oxo-N-[4-phenyl-3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-cyclopropyl-5-oxo-N-[4-phenyl-3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 97082963 |
| Molecular Formula | C21H19F3N2O2 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | (3R)-1-cyclopropyl-5-oxo-N-[4-phenyl-3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(-c2ccccc2)c(C(F)(F)F)c1)[C@@H]1CC(=O)N(C2CC2)C1 |
| InChI | InChI=1S/C21H19F3N2O2/c22-21(23,24)18-11-15(6-9-17(18)13-4-2-1-3-5-13)25-20(28)14-10-19(27)26(12-14)16-7-8-16/h1-6,9,11,14,16H,7-8,10,12H2,(H,25,28)/t14-/m1/s1 |
| InChIKey | AVSHWYMAGKZEBM-CQSZACIVSA-N |
| XLogP | 4.32 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |