C16H24N2O3S — CID 97090536
tert-butyl (3S)-3-methyl-3-(thiophen-3-ylcarbamoyl)piperidine-1-carboxylate (PubChem CID 97090536) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is tert-butyl (3S)-3-methyl-3-(thiophen-3-ylcarbamoyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-methyl-3-(thiophen-3-ylcarbamoyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97090536 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | tert-butyl (3S)-3-methyl-3-(thiophen-3-ylcarbamoyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@](C)(C(=O)Nc2ccsc2)C1 |
| InChI | InChI=1S/C16H24N2O3S/c1-15(2,3)21-14(20)18-8-5-7-16(4,11-18)13(19)17-12-6-9-22-10-12/h6,9-10H,5,7-8,11H2,1-4H3,(H,17,19)/t16-/m0/s1 |
| InChIKey | QRHSULKBNDXXDQ-INIZCTEOSA-N |
| XLogP | 3.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |