C13H27NO — CID 97091404
6-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]hexan-1-ol (PubChem CID 97091404) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is 6-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]hexan-1-ol.
| Compound Name | 6-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]hexan-1-ol |
|---|---|
| PubChem CID | 97091404 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 6-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]hexan-1-ol |
| SMILES | C[C@@H]1CN(CCCCCCO)C(C)(C)C1 |
| InChI | InChI=1S/C13H27NO/c1-12-10-13(2,3)14(11-12)8-6-4-5-7-9-15/h12,15H,4-11H2,1-3H3/t12-/m0/s1 |
| InChIKey | XHOHTEPLGIZVNY-LBPRGKRZSA-N |
| XLogP | 2.66 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|