C15H24N4O3S — CID 97094405
2-[(2S)-2,4-dimethylpiperazin-1-yl]-N-[(4-sulfamoylphenyl)methyl]acetamide (PubChem CID 97094405) has the molecular formula C15H24N4O3S and a molecular weight of 340.45 g/mol. Its IUPAC name is 2-[(2S)-2,4-dimethylpiperazin-1-yl]-N-[(4-sulfamoylphenyl)methyl]acetamide.
| Compound Name | 2-[(2S)-2,4-dimethylpiperazin-1-yl]-N-[(4-sulfamoylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 97094405 |
| Molecular Formula | C15H24N4O3S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 2-[(2S)-2,4-dimethylpiperazin-1-yl]-N-[(4-sulfamoylphenyl)methyl]acetamide |
| SMILES | C[C@H]1CN(C)CCN1CC(=O)NCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H24N4O3S/c1-12-10-18(2)7-8-19(12)11-15(20)17-9-13-3-5-14(6-4-13)23(16,21)22/h3-6,12H,7-11H2,1-2H3,(H,17,20)(H2,16,21,22)/t12-/m0/s1 |
| InChIKey | WFUANGAMLVHRFI-LBPRGKRZSA-N |
| XLogP | -0.41 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |