C10H18F3NO3S — CID 97098893
(1R)-2,2,2-trifluoro-1-(1-propylsulfonylpiperidin-4-yl)ethanol (PubChem CID 97098893) has the molecular formula C10H18F3NO3S and a molecular weight of 289.32 g/mol. Its IUPAC name is (1R)-2,2,2-trifluoro-1-(1-propylsulfonylpiperidin-4-yl)ethanol.
| Compound Name | (1R)-2,2,2-trifluoro-1-(1-propylsulfonylpiperidin-4-yl)ethanol |
|---|---|
| PubChem CID | 97098893 |
| Molecular Formula | C10H18F3NO3S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | (1R)-2,2,2-trifluoro-1-(1-propylsulfonylpiperidin-4-yl)ethanol |
| SMILES | CCCS(=O)(=O)N1CCC([C@@H](O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H18F3NO3S/c1-2-7-18(16,17)14-5-3-8(4-6-14)9(15)10(11,12)13/h8-9,15H,2-7H2,1H3/t9-/m1/s1 |
| InChIKey | PZQVHEFSNYCRAK-SECBINFHSA-N |
| XLogP | 1.36 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |