C17H24FNO2 — CID 97144601
[(3S)-1-[(4-fluoro-3-methoxyphenyl)methyl]-3-prop-2-enylpiperidin-3-yl]methanol (PubChem CID 97144601) has the molecular formula C17H24FNO2 and a molecular weight of 293.38 g/mol. Its IUPAC name is [(3S)-1-[(4-fluoro-3-methoxyphenyl)methyl]-3-prop-2-enylpiperidin-3-yl]methanol.
| Compound Name | [(3S)-1-[(4-fluoro-3-methoxyphenyl)methyl]-3-prop-2-enylpiperidin-3-yl]methanol |
|---|---|
| PubChem CID | 97144601 |
| Molecular Formula | C17H24FNO2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | [(3S)-1-[(4-fluoro-3-methoxyphenyl)methyl]-3-prop-2-enylpiperidin-3-yl]methanol |
| SMILES | C=CC[C@@]1(CO)CCCN(Cc2ccc(F)c(OC)c2)C1 |
| InChI | InChI=1S/C17H24FNO2/c1-3-7-17(13-20)8-4-9-19(12-17)11-14-5-6-15(18)16(10-14)21-2/h3,5-6,10,20H,1,4,7-9,11-13H2,2H3/t17-/m1/s1 |
| InChIKey | LKYWOONJYYZLSW-QGZVFWFLSA-N |
| XLogP | 2.98 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|