C20H31NO3 — CID 97131931
[5-[[(3R)-3-(hydroxymethyl)-3-prop-2-enylpiperidin-1-yl]methyl]-2-propan-2-yloxyphenyl]methanol (PubChem CID 97131931) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is [5-[[(3R)-3-(hydroxymethyl)-3-prop-2-enylpiperidin-1-yl]methyl]-2-propan-2-yloxyphenyl]methanol.
| Compound Name | [5-[[(3R)-3-(hydroxymethyl)-3-prop-2-enylpiperidin-1-yl]methyl]-2-propan-2-yloxyphenyl]methanol |
|---|---|
| PubChem CID | 97131931 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | [5-[[(3R)-3-(hydroxymethyl)-3-prop-2-enylpiperidin-1-yl]methyl]-2-propan-2-yloxyphenyl]methanol |
| SMILES | C=CC[C@]1(CO)CCCN(Cc2ccc(OC(C)C)c(CO)c2)C1 |
| InChI | InChI=1S/C20H31NO3/c1-4-8-20(15-23)9-5-10-21(14-20)12-17-6-7-19(24-16(2)3)18(11-17)13-22/h4,6-7,11,16,22-23H,1,5,8-10,12-15H2,2-3H3/t20-/m0/s1 |
| InChIKey | CCINYGOAIZRAGD-FQEVSTJZSA-N |
| XLogP | 3.12 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|