C10H9F6NO — CID 97178880
2-(2,2,3,3,4,4-hexafluorobutoxy)aniline (PubChem CID 97178880) has the molecular formula C10H9F6NO and a molecular weight of 273.18 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4-hexafluorobutoxy)aniline.
| Compound Name | 2-(2,2,3,3,4,4-hexafluorobutoxy)aniline |
|---|---|
| PubChem CID | 97178880 |
| Molecular Formula | C10H9F6NO |
| Molecular Weight | 273.18 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 2-(2,2,3,3,4,4-hexafluorobutoxy)aniline |
| SMILES | Nc1ccccc1OCC(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H9F6NO/c11-8(12)10(15,16)9(13,14)5-18-7-4-2-1-3-6(7)17/h1-4,8H,5,17H2 |
| InChIKey | RRTRULWSXXHISY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.18 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|