About methyl (2S,4R)-2-propan-2-yl-1,3-thiazolidine-4-carboxylate
methyl (2S,4R)-2-propan-2-yl-1,3-thiazolidine-4-carboxylate (PubChem CID 97184104) has the molecular formula C8H15NO2S
and a molecular weight of 189.28 g/mol. Its IUPAC name is methyl (2S,4R)-2-propan-2-yl-1,3-thiazolidine-4-carboxylate.
Analyze methyl (2S,4R)-2-propan-2-yl-1,3-thiazolidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S,4R)-2-propan-2-yl-1,3-thiazolidine-4-carboxylate?
The IUPAC name of methyl (2S,4R)-2-propan-2-yl-1,3-thiazolidine-4-carboxylate (CID 97184104) is methyl (2S,4R)-2-propan-2-yl-1,3-thiazolidine-4-carboxylate.
What is the SMILES notation for methyl (2S,4R)-2-propan-2-yl-1,3-thiazolidine-4-carboxylate?
The canonical SMILES for methyl (2S,4R)-2-propan-2-yl-1,3-thiazolidine-4-carboxylate is COC(=O)[C@@H]1CS[C@@H](C(C)C)N1.
What is the InChIKey of methyl (2S,4R)-2-propan-2-yl-1,3-thiazolidine-4-carboxylate?
The InChIKey is HFAMQEIRUQNGKY-BQBZGAKWSA-N. The full InChI is InChI=1S/C8H15NO2S/c1-5(2)7-9-6(4-12-7)8(10)11-3/h5-7,9H,4H2,1-3H3/t6-,7-/m0/s1.
What are the key properties of methyl (2S,4R)-2-propan-2-yl-1,3-thiazolidine-4-carboxylate?
methyl (2S,4R)-2-propan-2-yl-1,3-thiazolidine-4-carboxylate has a molecular weight of 189.28 g/mol, XLogP of 0.85, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S,4R)-2-propan-2-yl-1,3-thiazolidine-4-carboxylate is sourced from PubChem (CID 97184104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).