C22H32N4O3S — CID 97185775
1-benzyl-3-[3-tert-butyl-1-[(3S)-1,1-dioxothiolan-3-yl]pyrazol-5-yl]-1-propylurea (PubChem CID 97185775) has the molecular formula C22H32N4O3S and a molecular weight of 432.59 g/mol. Its IUPAC name is 1-benzyl-3-[3-tert-butyl-1-[(3S)-1,1-dioxothiolan-3-yl]pyrazol-5-yl]-1-propylurea.
| Compound Name | 1-benzyl-3-[3-tert-butyl-1-[(3S)-1,1-dioxothiolan-3-yl]pyrazol-5-yl]-1-propylurea |
|---|---|
| PubChem CID | 97185775 |
| Molecular Formula | C22H32N4O3S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 1-benzyl-3-[3-tert-butyl-1-[(3S)-1,1-dioxothiolan-3-yl]pyrazol-5-yl]-1-propylurea |
| SMILES | CCCN(Cc1ccccc1)C(=O)Nc1cc(C(C)(C)C)nn1[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H32N4O3S/c1-5-12-25(15-17-9-7-6-8-10-17)21(27)23-20-14-19(22(2,3)4)24-26(20)18-11-13-30(28,29)16-18/h6-10,14,18H,5,11-13,15-16H2,1-4H3,(H,23,27)/t18-/m0/s1 |
| InChIKey | QWGIXMYSJJJHOD-SFHVURJKSA-N |
| XLogP | 3.98 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |