C18H23N5 — CID 97188114
4-[(3R)-3-phenylpiperazin-1-yl]-5,6,7,8-tetrahydroquinazolin-2-amine (PubChem CID 97188114) has the molecular formula C18H23N5 and a molecular weight of 309.42 g/mol. Its IUPAC name is 4-[(3R)-3-phenylpiperazin-1-yl]-5,6,7,8-tetrahydroquinazolin-2-amine.
| Compound Name | 4-[(3R)-3-phenylpiperazin-1-yl]-5,6,7,8-tetrahydroquinazolin-2-amine |
|---|---|
| PubChem CID | 97188114 |
| Molecular Formula | C18H23N5 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 4-[(3R)-3-phenylpiperazin-1-yl]-5,6,7,8-tetrahydroquinazolin-2-amine |
| SMILES | Nc1nc2c(c(N3CCN[C@H](c4ccccc4)C3)n1)CCCC2 |
| InChI | InChI=1S/C18H23N5/c19-18-21-15-9-5-4-8-14(15)17(22-18)23-11-10-20-16(12-23)13-6-2-1-3-7-13/h1-3,6-7,16,20H,4-5,8-12H2,(H2,19,21,22)/t16-/m0/s1 |
| InChIKey | VUCGFLOUDGHWLN-INIZCTEOSA-N |
| XLogP | 2.09 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |