C18H18N2O4 — CID 97196762
[(1R)-1-naphthalen-2-ylethyl] 3-[(4R)-2,5-dioxoimidazolidin-4-yl]propanoate (PubChem CID 97196762) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is [(1R)-1-naphthalen-2-ylethyl] 3-[(4R)-2,5-dioxoimidazolidin-4-yl]propanoate.
| Compound Name | [(1R)-1-naphthalen-2-ylethyl] 3-[(4R)-2,5-dioxoimidazolidin-4-yl]propanoate |
|---|---|
| PubChem CID | 97196762 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | [(1R)-1-naphthalen-2-ylethyl] 3-[(4R)-2,5-dioxoimidazolidin-4-yl]propanoate |
| SMILES | C[C@@H](OC(=O)CC[C@H]1NC(=O)NC1=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H18N2O4/c1-11(13-7-6-12-4-2-3-5-14(12)10-13)24-16(21)9-8-15-17(22)20-18(23)19-15/h2-7,10-11,15H,8-9H2,1H3,(H2,19,20,22,23)/t11-,15-/m1/s1 |
| InChIKey | GHLSGAOSTGAERJ-IAQYHMDHSA-N |
| XLogP | 2.43 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|