C14H18N6OS — CID 97219637
(3R)-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)-N-(1,3-thiazol-2-yl)piperidine-1-carboxamide (PubChem CID 97219637) has the molecular formula C14H18N6OS and a molecular weight of 318.41 g/mol. Its IUPAC name is (3R)-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)-N-(1,3-thiazol-2-yl)piperidine-1-carboxamide.
| Compound Name | (3R)-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)-N-(1,3-thiazol-2-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 97219637 |
| Molecular Formula | C14H18N6OS |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (3R)-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)-N-(1,3-thiazol-2-yl)piperidine-1-carboxamide |
| SMILES | O=C(Nc1nccs1)N1CCC[C@@H](c2nnc3n2CCC3)C1 |
| InChI | InChI=1S/C14H18N6OS/c21-14(16-13-15-5-8-22-13)19-6-1-3-10(9-19)12-18-17-11-4-2-7-20(11)12/h5,8,10H,1-4,6-7,9H2,(H,15,16,21)/t10-/m1/s1 |
| InChIKey | ZOROMWXGLBMSAM-SNVBAGLBSA-N |
| XLogP | 2.09 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |