C15H20F2O2S — CID 97221001
(2S)-2-[[(R)-[(1R)-1-(2,4-difluorophenyl)propyl]sulfinyl]methyl]oxane (PubChem CID 97221001) has the molecular formula C15H20F2O2S and a molecular weight of 302.39 g/mol. Its IUPAC name is (2S)-2-[[(R)-[(1R)-1-(2,4-difluorophenyl)propyl]sulfinyl]methyl]oxane.
| Compound Name | (2S)-2-[[(R)-[(1R)-1-(2,4-difluorophenyl)propyl]sulfinyl]methyl]oxane |
|---|---|
| PubChem CID | 97221001 |
| Molecular Formula | C15H20F2O2S |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (2S)-2-[[(R)-[(1R)-1-(2,4-difluorophenyl)propyl]sulfinyl]methyl]oxane |
| SMILES | CC[C@H](c1ccc(F)cc1F)[S@](=O)C[C@@H]1CCCCO1 |
| InChI | InChI=1S/C15H20F2O2S/c1-2-15(13-7-6-11(16)9-14(13)17)20(18)10-12-5-3-4-8-19-12/h6-7,9,12,15H,2-5,8,10H2,1H3/t12-,15+,20+/m0/s1 |
| InChIKey | SABMURBEWQUDKQ-PGICJIBASA-N |
| XLogP | 3.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |