C20H24BrN3O2 — CID 97223366
[(4aR,8aS)-2,3,4,4a,5,7,8,8a-octahydropyrano[4,3-b]pyridin-1-yl]-[4-(4-bromo-3,5-dimethylpyrazol-1-yl)phenyl]methanone (PubChem CID 97223366) has the molecular formula C20H24BrN3O2 and a molecular weight of 418.34 g/mol. Its IUPAC name is [(4aR,8aS)-2,3,4,4a,5,7,8,8a-octahydropyrano[4,3-b]pyridin-1-yl]-[4-(4-bromo-3,5-dimethylpyrazol-1-yl)phenyl]methanone.
| Compound Name | [(4aR,8aS)-2,3,4,4a,5,7,8,8a-octahydropyrano[4,3-b]pyridin-1-yl]-[4-(4-bromo-3,5-dimethylpyrazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 97223366 |
| Molecular Formula | C20H24BrN3O2 |
| Molecular Weight | 418.34 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | [(4aR,8aS)-2,3,4,4a,5,7,8,8a-octahydropyrano[4,3-b]pyridin-1-yl]-[4-(4-bromo-3,5-dimethylpyrazol-1-yl)phenyl]methanone |
| SMILES | Cc1nn(-c2ccc(C(=O)N3CCC[C@H]4COCC[C@@H]43)cc2)c(C)c1Br |
| InChI | InChI=1S/C20H24BrN3O2/c1-13-19(21)14(2)24(22-13)17-7-5-15(6-8-17)20(25)23-10-3-4-16-12-26-11-9-18(16)23/h5-8,16,18H,3-4,9-12H2,1-2H3/t16-,18-/m0/s1 |
| InChIKey | OZWTZJVXJCMKOK-WMZOPIPTSA-N |
| XLogP | 3.89 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |