C26H30N4O — CID 44763728
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[4-[5-amino-3-(3-methylphenyl)pyrazol-1-yl]phenyl]methanone (PubChem CID 44763728) has the molecular formula C26H30N4O and a molecular weight of 414.55 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[4-[5-amino-3-(3-methylphenyl)pyrazol-1-yl]phenyl]methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[4-[5-amino-3-(3-methylphenyl)pyrazol-1-yl]phenyl]methanone |
|---|---|
| PubChem CID | 44763728 |
| Molecular Formula | C26H30N4O |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[4-[5-amino-3-(3-methylphenyl)pyrazol-1-yl]phenyl]methanone |
| SMILES | Cc1cccc(-c2cc(N)n(-c3ccc(C(=O)N4CCCC5CCCCC54)cc3)n2)c1 |
| InChI | InChI=1S/C26H30N4O/c1-18-6-4-8-21(16-18)23-17-25(27)30(28-23)22-13-11-20(12-14-22)26(31)29-15-5-9-19-7-2-3-10-24(19)29/h4,6,8,11-14,16-17,19,24H,2-3,5,7,9-10,15,27H2,1H3 |
| InChIKey | LIEBICAOHZHYHD-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |