C13H17F2NO2S — CID 97225421
4-[(R)-(3,4-difluorophenyl)methylsulfinyl]-N,N-dimethylbutanamide (PubChem CID 97225421) has the molecular formula C13H17F2NO2S and a molecular weight of 289.35 g/mol. Its IUPAC name is 4-[(R)-(3,4-difluorophenyl)methylsulfinyl]-N,N-dimethylbutanamide.
| Compound Name | 4-[(R)-(3,4-difluorophenyl)methylsulfinyl]-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 97225421 |
| Molecular Formula | C13H17F2NO2S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 4-[(R)-(3,4-difluorophenyl)methylsulfinyl]-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCC[S@@](=O)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H17F2NO2S/c1-16(2)13(17)4-3-7-19(18)9-10-5-6-11(14)12(15)8-10/h5-6,8H,3-4,7,9H2,1-2H3/t19-/m1/s1 |
| InChIKey | SQWJOBPSUVEYGN-LJQANCHMSA-N |
| XLogP | 2.08 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |