C16H15F3N2O3 — CID 97225818
methyl (2R)-2-[methyl-(2-methyl-1H-pyrrole-3-carbonyl)amino]-2-(3,4,5-trifluorophenyl)acetate (PubChem CID 97225818) has the molecular formula C16H15F3N2O3 and a molecular weight of 340.30 g/mol. Its IUPAC name is methyl (2R)-2-[methyl-(2-methyl-1H-pyrrole-3-carbonyl)amino]-2-(3,4,5-trifluorophenyl)acetate.
| Compound Name | methyl (2R)-2-[methyl-(2-methyl-1H-pyrrole-3-carbonyl)amino]-2-(3,4,5-trifluorophenyl)acetate |
|---|---|
| PubChem CID | 97225818 |
| Molecular Formula | C16H15F3N2O3 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | methyl (2R)-2-[methyl-(2-methyl-1H-pyrrole-3-carbonyl)amino]-2-(3,4,5-trifluorophenyl)acetate |
| SMILES | COC(=O)[C@@H](c1cc(F)c(F)c(F)c1)N(C)C(=O)c1cc[nH]c1C |
| InChI | InChI=1S/C16H15F3N2O3/c1-8-10(4-5-20-8)15(22)21(2)14(16(23)24-3)9-6-11(17)13(19)12(18)7-9/h4-7,14,20H,1-3H3/t14-/m1/s1 |
| InChIKey | ALEGETAADFDTJC-CQSZACIVSA-N |
| XLogP | 2.73 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|