C13H18BrClN2O2 — CID 97235531
3-[(4-bromo-2-chlorophenyl)methyl]-1-[(3R)-3-hydroxybutyl]-1-methylurea (PubChem CID 97235531) has the molecular formula C13H18BrClN2O2 and a molecular weight of 349.66 g/mol. Its IUPAC name is 3-[(4-bromo-2-chlorophenyl)methyl]-1-[(3R)-3-hydroxybutyl]-1-methylurea.
| Compound Name | 3-[(4-bromo-2-chlorophenyl)methyl]-1-[(3R)-3-hydroxybutyl]-1-methylurea |
|---|---|
| PubChem CID | 97235531 |
| Molecular Formula | C13H18BrClN2O2 |
| Molecular Weight | 349.66 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 3-[(4-bromo-2-chlorophenyl)methyl]-1-[(3R)-3-hydroxybutyl]-1-methylurea |
| SMILES | C[C@@H](O)CCN(C)C(=O)NCc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C13H18BrClN2O2/c1-9(18)5-6-17(2)13(19)16-8-10-3-4-11(14)7-12(10)15/h3-4,7,9,18H,5-6,8H2,1-2H3,(H,16,19)/t9-/m1/s1 |
| InChIKey | OQEUPQCQWSAXQU-SECBINFHSA-N |
| XLogP | 3.01 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.66 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |