C18H19N3O4 — CID 97236257
[(2R)-pyrrolidin-2-yl]methyl 3-[(1-oxidopyridin-1-ium-2-carbonyl)amino]benzoate (PubChem CID 97236257) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is [(2R)-pyrrolidin-2-yl]methyl 3-[(1-oxidopyridin-1-ium-2-carbonyl)amino]benzoate.
| Compound Name | [(2R)-pyrrolidin-2-yl]methyl 3-[(1-oxidopyridin-1-ium-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 97236257 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | [(2R)-pyrrolidin-2-yl]methyl 3-[(1-oxidopyridin-1-ium-2-carbonyl)amino]benzoate |
| SMILES | O=C(OC[C@H]1CCCN1)c1cccc(NC(=O)c2cccc[n+]2[O-])c1 |
| InChI | InChI=1S/C18H19N3O4/c22-17(16-8-1-2-10-21(16)24)20-14-6-3-5-13(11-14)18(23)25-12-15-7-4-9-19-15/h1-3,5-6,8,10-11,15,19H,4,7,9,12H2,(H,20,22)/t15-/m1/s1 |
| InChIKey | HHVHHGIRYCQDKO-OAHLLOKOSA-N |
| XLogP | 1.48 |
| TPSA | 94.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|