C12H19NO3 — CID 97243038
2-[(1R)-cyclopent-2-en-1-yl]-N-[[(3S)-3-hydroxyoxolan-3-yl]methyl]acetamide (PubChem CID 97243038) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 2-[(1R)-cyclopent-2-en-1-yl]-N-[[(3S)-3-hydroxyoxolan-3-yl]methyl]acetamide.
| Compound Name | 2-[(1R)-cyclopent-2-en-1-yl]-N-[[(3S)-3-hydroxyoxolan-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 97243038 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 2-[(1R)-cyclopent-2-en-1-yl]-N-[[(3S)-3-hydroxyoxolan-3-yl]methyl]acetamide |
| SMILES | O=C(C[C@@H]1C=CCC1)NC[C@@]1(O)CCOC1 |
| InChI | InChI=1S/C12H19NO3/c14-11(7-10-3-1-2-4-10)13-8-12(15)5-6-16-9-12/h1,3,10,15H,2,4-9H2,(H,13,14)/t10-,12+/m1/s1 |
| InChIKey | YWPWEPDTHMAFIJ-PWSUYJOCSA-N |
| XLogP | 0.61 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|