C14H21FN2O5S2 — CID 97246904
(2S)-N-[3-fluoro-4-(propan-2-ylsulfonylamino)phenyl]sulfonyl-2-methylbutanamide (PubChem CID 97246904) has the molecular formula C14H21FN2O5S2 and a molecular weight of 380.46 g/mol. Its IUPAC name is (2S)-N-[3-fluoro-4-(propan-2-ylsulfonylamino)phenyl]sulfonyl-2-methylbutanamide.
| Compound Name | (2S)-N-[3-fluoro-4-(propan-2-ylsulfonylamino)phenyl]sulfonyl-2-methylbutanamide |
|---|---|
| PubChem CID | 97246904 |
| Molecular Formula | C14H21FN2O5S2 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | (2S)-N-[3-fluoro-4-(propan-2-ylsulfonylamino)phenyl]sulfonyl-2-methylbutanamide |
| SMILES | CC[C@H](C)C(=O)NS(=O)(=O)c1ccc(NS(=O)(=O)C(C)C)c(F)c1 |
| InChI | InChI=1S/C14H21FN2O5S2/c1-5-10(4)14(18)17-24(21,22)11-6-7-13(12(15)8-11)16-23(19,20)9(2)3/h6-10,16H,5H2,1-4H3,(H,17,18)/t10-/m0/s1 |
| InChIKey | YDOWFAUWEGJGPO-JTQLQIEISA-N |
| XLogP | 1.83 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |