C16H20N2O4S — CID 97247001
(5R)-3-[(1,1-dioxothian-4-yl)methyl]-5-methyl-5-phenylimidazolidine-2,4-dione (PubChem CID 97247001) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is (5R)-3-[(1,1-dioxothian-4-yl)methyl]-5-methyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(1,1-dioxothian-4-yl)methyl]-5-methyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 97247001 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | (5R)-3-[(1,1-dioxothian-4-yl)methyl]-5-methyl-5-phenylimidazolidine-2,4-dione |
| SMILES | C[C@]1(c2ccccc2)NC(=O)N(CC2CCS(=O)(=O)CC2)C1=O |
| InChI | InChI=1S/C16H20N2O4S/c1-16(13-5-3-2-4-6-13)14(19)18(15(20)17-16)11-12-7-9-23(21,22)10-8-12/h2-6,12H,7-11H2,1H3,(H,17,20)/t16-/m1/s1 |
| InChIKey | KFZZYVLNLMBKLR-MRXNPFEDSA-N |
| XLogP | 1.28 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|