About furan-3-ylmethyl 2-[(2R)-oxolan-2-yl]-1,3-thiazole-5-carboxylate
furan-3-ylmethyl 2-[(2R)-oxolan-2-yl]-1,3-thiazole-5-carboxylate (PubChem CID 97247375) has the molecular formula C13H13NO4S
and a molecular weight of 279.32 g/mol. Its IUPAC name is furan-3-ylmethyl 2-[(2R)-oxolan-2-yl]-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | furan-3-ylmethyl 2-[(2R)-oxolan-2-yl]-1,3-thiazole-5-carboxylate |
| PubChem CID | 97247375 |
| Molecular Formula | C13H13NO4S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | furan-3-ylmethyl 2-[(2R)-oxolan-2-yl]-1,3-thiazole-5-carboxylate |
| SMILES | O=C(OCc1ccoc1)c1cnc([C@H]2CCCO2)s1 |
| InChI | InChI=1S/C13H13NO4S/c15-13(18-8-9-3-5-16-7-9)11-6-14-12(19-11)10-2-1-4-17-10/h3,5-7,10H,1-2,4,8H2/t10-/m1/s1 |
| InChIKey | MNCNVRNASMWZTQ-SNVBAGLBSA-N |
| XLogP | 2.94 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze furan-3-ylmethyl 2-[(2R)-oxolan-2-yl]-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-3-ylmethyl 2-[(2R)-oxolan-2-yl]-1,3-thiazole-5-carboxylate?
The IUPAC name of furan-3-ylmethyl 2-[(2R)-oxolan-2-yl]-1,3-thiazole-5-carboxylate (CID 97247375) is furan-3-ylmethyl 2-[(2R)-oxolan-2-yl]-1,3-thiazole-5-carboxylate.
What is the SMILES notation for furan-3-ylmethyl 2-[(2R)-oxolan-2-yl]-1,3-thiazole-5-carboxylate?
The canonical SMILES for furan-3-ylmethyl 2-[(2R)-oxolan-2-yl]-1,3-thiazole-5-carboxylate is O=C(OCc1ccoc1)c1cnc([C@H]2CCCO2)s1.
What is the InChIKey of furan-3-ylmethyl 2-[(2R)-oxolan-2-yl]-1,3-thiazole-5-carboxylate?
The InChIKey is MNCNVRNASMWZTQ-SNVBAGLBSA-N. The full InChI is InChI=1S/C13H13NO4S/c15-13(18-8-9-3-5-16-7-9)11-6-14-12(19-11)10-2-1-4-17-10/h3,5-7,10H,1-2,4,8H2/t10-/m1/s1.
What are the key properties of furan-3-ylmethyl 2-[(2R)-oxolan-2-yl]-1,3-thiazole-5-carboxylate?
furan-3-ylmethyl 2-[(2R)-oxolan-2-yl]-1,3-thiazole-5-carboxylate has a molecular weight of 279.32 g/mol, XLogP of 2.94, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for furan-3-ylmethyl 2-[(2R)-oxolan-2-yl]-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 97247375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).