C24H26FN3O2 — CID 97256758
N-[2-(3-fluorophenoxy)ethyl]-2-[methyl-[(1S)-1-(3-pyridin-4-ylphenyl)ethyl]amino]acetamide (PubChem CID 97256758) has the molecular formula C24H26FN3O2 and a molecular weight of 407.49 g/mol. Its IUPAC name is N-[2-(3-fluorophenoxy)ethyl]-2-[methyl-[(1S)-1-(3-pyridin-4-ylphenyl)ethyl]amino]acetamide.
| Compound Name | N-[2-(3-fluorophenoxy)ethyl]-2-[methyl-[(1S)-1-(3-pyridin-4-ylphenyl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 97256758 |
| Molecular Formula | C24H26FN3O2 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | N-[2-(3-fluorophenoxy)ethyl]-2-[methyl-[(1S)-1-(3-pyridin-4-ylphenyl)ethyl]amino]acetamide |
| SMILES | C[C@@H](c1cccc(-c2ccncc2)c1)N(C)CC(=O)NCCOc1cccc(F)c1 |
| InChI | InChI=1S/C24H26FN3O2/c1-18(20-5-3-6-21(15-20)19-9-11-26-12-10-19)28(2)17-24(29)27-13-14-30-23-8-4-7-22(25)16-23/h3-12,15-16,18H,13-14,17H2,1-2H3,(H,27,29)/t18-/m0/s1 |
| InChIKey | LSQIUJRYJRIVFC-SFHVURJKSA-N |
| XLogP | 4.08 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|