C19H24N6O3 — CID 97269808
(2S)-N-[3-(butanoylamino)phenyl]-2-(1H-imidazol-5-ylmethyl)-3-oxopiperazine-1-carboxamide (PubChem CID 97269808) has the molecular formula C19H24N6O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is (2S)-N-[3-(butanoylamino)phenyl]-2-(1H-imidazol-5-ylmethyl)-3-oxopiperazine-1-carboxamide.
| Compound Name | (2S)-N-[3-(butanoylamino)phenyl]-2-(1H-imidazol-5-ylmethyl)-3-oxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 97269808 |
| Molecular Formula | C19H24N6O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | (2S)-N-[3-(butanoylamino)phenyl]-2-(1H-imidazol-5-ylmethyl)-3-oxopiperazine-1-carboxamide |
| SMILES | CCCC(=O)Nc1cccc(NC(=O)N2CCNC(=O)[C@@H]2Cc2cnc[nH]2)c1 |
| InChI | InChI=1S/C19H24N6O3/c1-2-4-17(26)23-13-5-3-6-14(9-13)24-19(28)25-8-7-21-18(27)16(25)10-15-11-20-12-22-15/h3,5-6,9,11-12,16H,2,4,7-8,10H2,1H3,(H,20,22)(H,21,27)(H,23,26)(H,24,28)/t16-/m0/s1 |
| InChIKey | BIWIVVHVEMPRJT-INIZCTEOSA-N |
| XLogP | 1.72 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |