C18H23N5O3 — CID 74236705
3-(1H-imidazol-5-ylmethyl)-4-[5-(pyrrolidin-1-ylmethyl)furan-2-carbonyl]piperazin-2-one (PubChem CID 74236705) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is 3-(1H-imidazol-5-ylmethyl)-4-[5-(pyrrolidin-1-ylmethyl)furan-2-carbonyl]piperazin-2-one.
| Compound Name | 3-(1H-imidazol-5-ylmethyl)-4-[5-(pyrrolidin-1-ylmethyl)furan-2-carbonyl]piperazin-2-one |
|---|---|
| PubChem CID | 74236705 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 3-(1H-imidazol-5-ylmethyl)-4-[5-(pyrrolidin-1-ylmethyl)furan-2-carbonyl]piperazin-2-one |
| SMILES | O=C1NCCN(C(=O)c2ccc(CN3CCCC3)o2)C1Cc1cnc[nH]1 |
| InChI | InChI=1S/C18H23N5O3/c24-17-15(9-13-10-19-12-21-13)23(8-5-20-17)18(25)16-4-3-14(26-16)11-22-6-1-2-7-22/h3-4,10,12,15H,1-2,5-9,11H2,(H,19,21)(H,20,24) |
| InChIKey | NECMZFMGQZCRDN-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |