C18H20N6O2 — CID 97285904
(2R)-N-(4-cyano-2-ethylphenyl)-2-(1H-imidazol-5-ylmethyl)-3-oxopiperazine-1-carboxamide (PubChem CID 97285904) has the molecular formula C18H20N6O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is (2R)-N-(4-cyano-2-ethylphenyl)-2-(1H-imidazol-5-ylmethyl)-3-oxopiperazine-1-carboxamide.
| Compound Name | (2R)-N-(4-cyano-2-ethylphenyl)-2-(1H-imidazol-5-ylmethyl)-3-oxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 97285904 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | (2R)-N-(4-cyano-2-ethylphenyl)-2-(1H-imidazol-5-ylmethyl)-3-oxopiperazine-1-carboxamide |
| SMILES | CCc1cc(C#N)ccc1NC(=O)N1CCNC(=O)[C@H]1Cc1cnc[nH]1 |
| InChI | InChI=1S/C18H20N6O2/c1-2-13-7-12(9-19)3-4-15(13)23-18(26)24-6-5-21-17(25)16(24)8-14-10-20-11-22-14/h3-4,7,10-11,16H,2,5-6,8H2,1H3,(H,20,22)(H,21,25)(H,23,26)/t16-/m1/s1 |
| InChIKey | PTBDLBBAVVZNMS-MRXNPFEDSA-N |
| XLogP | 1.42 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |