C22H20ClNO3 — CID 97282351
(3R)-3-(2-chlorophenyl)-N-[(2,4-dihydroxyphenyl)methyl]-3-phenylpropanamide (PubChem CID 97282351) has the molecular formula C22H20ClNO3 and a molecular weight of 381.86 g/mol. Its IUPAC name is (3R)-3-(2-chlorophenyl)-N-[(2,4-dihydroxyphenyl)methyl]-3-phenylpropanamide.
| Compound Name | (3R)-3-(2-chlorophenyl)-N-[(2,4-dihydroxyphenyl)methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 97282351 |
| Molecular Formula | C22H20ClNO3 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | (3R)-3-(2-chlorophenyl)-N-[(2,4-dihydroxyphenyl)methyl]-3-phenylpropanamide |
| SMILES | O=C(C[C@H](c1ccccc1)c1ccccc1Cl)NCc1ccc(O)cc1O |
| InChI | InChI=1S/C22H20ClNO3/c23-20-9-5-4-8-18(20)19(15-6-2-1-3-7-15)13-22(27)24-14-16-10-11-17(25)12-21(16)26/h1-12,19,25-26H,13-14H2,(H,24,27)/t19-/m1/s1 |
| InChIKey | DUJPPPDMYSVSAJ-LJQANCHMSA-N |
| XLogP | 4.59 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|