C15H13N3OS — CID 973002
3-methyl-4-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]phenol (PubChem CID 973002) has the molecular formula C15H13N3OS and a molecular weight of 283.36 g/mol. Its IUPAC name is 3-methyl-4-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]phenol.
| Compound Name | 3-methyl-4-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]phenol |
|---|---|
| PubChem CID | 973002 |
| Molecular Formula | C15H13N3OS |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 3-methyl-4-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]phenol |
| SMILES | Cc1cc(O)ccc1Nc1nc(-c2cccnc2)cs1 |
| InChI | InChI=1S/C15H13N3OS/c1-10-7-12(19)4-5-13(10)17-15-18-14(9-20-15)11-3-2-6-16-8-11/h2-9,19H,1H3,(H,17,18) |
| InChIKey | PQGFKOQKMYHLRJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|