C17H18N2O5 — CID 97317232
[(3R)-3-(5-methylfuran-2-yl)morpholin-4-yl]-(4-methyl-3-nitrophenyl)methanone (PubChem CID 97317232) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is [(3R)-3-(5-methylfuran-2-yl)morpholin-4-yl]-(4-methyl-3-nitrophenyl)methanone.
| Compound Name | [(3R)-3-(5-methylfuran-2-yl)morpholin-4-yl]-(4-methyl-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 97317232 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | [(3R)-3-(5-methylfuran-2-yl)morpholin-4-yl]-(4-methyl-3-nitrophenyl)methanone |
| SMILES | Cc1ccc([C@H]2COCCN2C(=O)c2ccc(C)c([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C17H18N2O5/c1-11-3-5-13(9-14(11)19(21)22)17(20)18-7-8-23-10-15(18)16-6-4-12(2)24-16/h3-6,9,15H,7-8,10H2,1-2H3/t15-/m1/s1 |
| InChIKey | HLHJDDPJBKHFLS-OAHLLOKOSA-N |
| XLogP | 3.02 |
| TPSA | 85.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|