C17H22IN3O3 — CID 97320716
4-hydroxy-N-[(4S)-4-hydroxy-2,2-dimethylpentyl]-1-(2-iodophenyl)pyrazole-3-carboxamide (PubChem CID 97320716) has the molecular formula C17H22IN3O3 and a molecular weight of 443.29 g/mol. Its IUPAC name is 4-hydroxy-N-[(4S)-4-hydroxy-2,2-dimethylpentyl]-1-(2-iodophenyl)pyrazole-3-carboxamide.
| Compound Name | 4-hydroxy-N-[(4S)-4-hydroxy-2,2-dimethylpentyl]-1-(2-iodophenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 97320716 |
| Molecular Formula | C17H22IN3O3 |
| Molecular Weight | 443.29 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | 4-hydroxy-N-[(4S)-4-hydroxy-2,2-dimethylpentyl]-1-(2-iodophenyl)pyrazole-3-carboxamide |
| SMILES | C[C@H](O)CC(C)(C)CNC(=O)c1nn(-c2ccccc2I)cc1O |
| InChI | InChI=1S/C17H22IN3O3/c1-11(22)8-17(2,3)10-19-16(24)15-14(23)9-21(20-15)13-7-5-4-6-12(13)18/h4-7,9,11,22-23H,8,10H2,1-3H3,(H,19,24)/t11-/m0/s1 |
| InChIKey | RVIMCZXLVMWJIT-NSHDSACASA-N |
| XLogP | 2.71 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|