C20H28N2O2 — CID 97335465
4-(1H-indol-3-yl)-N-[(1R,3R,4S)-3-methoxy-2,2,4-trimethylcyclobutyl]butanamide (PubChem CID 97335465) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 4-(1H-indol-3-yl)-N-[(1R,3R,4S)-3-methoxy-2,2,4-trimethylcyclobutyl]butanamide.
| Compound Name | 4-(1H-indol-3-yl)-N-[(1R,3R,4S)-3-methoxy-2,2,4-trimethylcyclobutyl]butanamide |
|---|---|
| PubChem CID | 97335465 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 4-(1H-indol-3-yl)-N-[(1R,3R,4S)-3-methoxy-2,2,4-trimethylcyclobutyl]butanamide |
| SMILES | CO[C@@H]1[C@@H](C)[C@@H](NC(=O)CCCc2c[nH]c3ccccc23)C1(C)C |
| InChI | InChI=1S/C20H28N2O2/c1-13-18(20(2,3)19(13)24-4)22-17(23)11-7-8-14-12-21-16-10-6-5-9-15(14)16/h5-6,9-10,12-13,18-19,21H,7-8,11H2,1-4H3,(H,22,23)/t13-,18+,19+/m0/s1 |
| InChIKey | SDZMFZOGXYIVLM-MJXNMMHHSA-N |
| XLogP | 3.67 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |