C17H19FN2O2S — CID 97338443
4-[(1S)-1-[[1-(2-fluorophenyl)cyclopropyl]amino]ethyl]benzenesulfonamide (PubChem CID 97338443) has the molecular formula C17H19FN2O2S and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-[(1S)-1-[[1-(2-fluorophenyl)cyclopropyl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[(1S)-1-[[1-(2-fluorophenyl)cyclopropyl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 97338443 |
| Molecular Formula | C17H19FN2O2S |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 4-[(1S)-1-[[1-(2-fluorophenyl)cyclopropyl]amino]ethyl]benzenesulfonamide |
| SMILES | C[C@H](NC1(c2ccccc2F)CC1)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C17H19FN2O2S/c1-12(13-6-8-14(9-7-13)23(19,21)22)20-17(10-11-17)15-4-2-3-5-16(15)18/h2-9,12,20H,10-11H2,1H3,(H2,19,21,22)/t12-/m0/s1 |
| InChIKey | DIWNSITVBKUINA-LBPRGKRZSA-N |
| XLogP | 2.81 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |