C16H19FN2O3S — CID 97340131
4-[(2R)-2-[2-(4-fluorophenyl)-2-oxoethyl]pyrrolidin-1-yl]sulfonylbutanenitrile (PubChem CID 97340131) has the molecular formula C16H19FN2O3S and a molecular weight of 338.40 g/mol. Its IUPAC name is 4-[(2R)-2-[2-(4-fluorophenyl)-2-oxoethyl]pyrrolidin-1-yl]sulfonylbutanenitrile.
| Compound Name | 4-[(2R)-2-[2-(4-fluorophenyl)-2-oxoethyl]pyrrolidin-1-yl]sulfonylbutanenitrile |
|---|---|
| PubChem CID | 97340131 |
| Molecular Formula | C16H19FN2O3S |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 4-[(2R)-2-[2-(4-fluorophenyl)-2-oxoethyl]pyrrolidin-1-yl]sulfonylbutanenitrile |
| SMILES | N#CCCCS(=O)(=O)N1CCC[C@@H]1CC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H19FN2O3S/c17-14-7-5-13(6-8-14)16(20)12-15-4-3-10-19(15)23(21,22)11-2-1-9-18/h5-8,15H,1-4,10-12H2/t15-/m1/s1 |
| InChIKey | QUTMHEKDMXDHHI-OAHLLOKOSA-N |
| XLogP | 2.50 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|