C15H20FN5O2S — CID 97346645
(6R)-6-[[ethyl(methyl)sulfamoyl]amino]-3-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 97346645) has the molecular formula C15H20FN5O2S and a molecular weight of 353.42 g/mol. Its IUPAC name is (6R)-6-[[ethyl(methyl)sulfamoyl]amino]-3-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | (6R)-6-[[ethyl(methyl)sulfamoyl]amino]-3-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 97346645 |
| Molecular Formula | C15H20FN5O2S |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | (6R)-6-[[ethyl(methyl)sulfamoyl]amino]-3-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | CCN(C)S(=O)(=O)N[C@@H]1CCc2nnc(-c3ccc(F)cc3)n2C1 |
| InChI | InChI=1S/C15H20FN5O2S/c1-3-20(2)24(22,23)19-13-8-9-14-17-18-15(21(14)10-13)11-4-6-12(16)7-5-11/h4-7,13,19H,3,8-10H2,1-2H3/t13-/m1/s1 |
| InChIKey | ITBVRWPRCIULIL-CYBMUJFWSA-N |
| XLogP | 1.19 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |