C20H31N3O5S — CID 97347639
(2R)-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)-2-(propan-2-ylideneamino)oxyhexanamide (PubChem CID 97347639) has the molecular formula C20H31N3O5S and a molecular weight of 425.55 g/mol. Its IUPAC name is (2R)-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)-2-(propan-2-ylideneamino)oxyhexanamide.
| Compound Name | (2R)-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)-2-(propan-2-ylideneamino)oxyhexanamide |
|---|---|
| PubChem CID | 97347639 |
| Molecular Formula | C20H31N3O5S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | (2R)-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)-2-(propan-2-ylideneamino)oxyhexanamide |
| SMILES | CCCC[C@@H](ON=C(C)C)C(=O)Nc1ccc(C)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C20H31N3O5S/c1-5-6-7-18(28-22-15(2)3)20(24)21-17-9-8-16(4)19(14-17)29(25,26)23-10-12-27-13-11-23/h8-9,14,18H,5-7,10-13H2,1-4H3,(H,21,24)/t18-/m1/s1 |
| InChIKey | XQSONXSOFUPPAF-GOSISDBHSA-N |
| XLogP | 2.93 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|