C16H22ClFN2O2 — CID 97349144
1-(azepan-1-yl)-2-[[(1S)-1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]amino]ethanone (PubChem CID 97349144) has the molecular formula C16H22ClFN2O2 and a molecular weight of 328.81 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[[(1S)-1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]amino]ethanone.
| Compound Name | 1-(azepan-1-yl)-2-[[(1S)-1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]amino]ethanone |
|---|---|
| PubChem CID | 97349144 |
| Molecular Formula | C16H22ClFN2O2 |
| Molecular Weight | 328.81 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 1-(azepan-1-yl)-2-[[(1S)-1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]amino]ethanone |
| SMILES | O=C(CN[C@H](CO)c1ccc(Cl)c(F)c1)N1CCCCCC1 |
| InChI | InChI=1S/C16H22ClFN2O2/c17-13-6-5-12(9-14(13)18)15(11-21)19-10-16(22)20-7-3-1-2-4-8-20/h5-6,9,15,19,21H,1-4,7-8,10-11H2/t15-/m1/s1 |
| InChIKey | XUTIUAZSULVLKF-OAHLLOKOSA-N |
| XLogP | 2.50 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.81 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |