C18H15F2NO4 — CID 97352997
[(1S)-1-cyano-2-(2,4-difluorophenyl)ethyl] 3,4-dimethoxybenzoate (PubChem CID 97352997) has the molecular formula C18H15F2NO4 and a molecular weight of 347.32 g/mol. Its IUPAC name is [(1S)-1-cyano-2-(2,4-difluorophenyl)ethyl] 3,4-dimethoxybenzoate.
| Compound Name | [(1S)-1-cyano-2-(2,4-difluorophenyl)ethyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 97352997 |
| Molecular Formula | C18H15F2NO4 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | [(1S)-1-cyano-2-(2,4-difluorophenyl)ethyl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)O[C@H](C#N)Cc2ccc(F)cc2F)cc1OC |
| InChI | InChI=1S/C18H15F2NO4/c1-23-16-6-4-12(8-17(16)24-2)18(22)25-14(10-21)7-11-3-5-13(19)9-15(11)20/h3-6,8-9,14H,7H2,1-2H3/t14-/m0/s1 |
| InChIKey | OFXGBAKYFOTORX-AWEZNQCLSA-N |
| XLogP | 3.27 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |