C10H7F2NO2 — CID 129353721
(2R)-2-cyano-3-(2,4-difluorophenyl)propanoic acid (PubChem CID 129353721) has the molecular formula C10H7F2NO2 and a molecular weight of 211.17 g/mol. Its IUPAC name is (2R)-2-cyano-3-(2,4-difluorophenyl)propanoic acid.
| Compound Name | (2R)-2-cyano-3-(2,4-difluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 129353721 |
| Molecular Formula | C10H7F2NO2 |
| Molecular Weight | 211.17 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | (2R)-2-cyano-3-(2,4-difluorophenyl)propanoic acid |
| SMILES | N#C[C@@H](Cc1ccc(F)cc1F)C(=O)O |
| InChI | InChI=1S/C10H7F2NO2/c11-8-2-1-6(9(12)4-8)3-7(5-13)10(14)15/h1-2,4,7H,3H2,(H,14,15)/t7-/m1/s1 |
| InChIKey | LKRPEENNIIRZAJ-SSDOTTSWSA-N |
| XLogP | 1.73 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.17 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |