C18H13N5O3 — CID 97359668
(E)-2-cyano-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-imidazo[1,2-a]pyrazin-3-ylprop-2-enamide (PubChem CID 97359668) has the molecular formula C18H13N5O3 and a molecular weight of 347.33 g/mol. Its IUPAC name is (E)-2-cyano-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-imidazo[1,2-a]pyrazin-3-ylprop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-imidazo[1,2-a]pyrazin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 97359668 |
| Molecular Formula | C18H13N5O3 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | (E)-2-cyano-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-imidazo[1,2-a]pyrazin-3-ylprop-2-enamide |
| SMILES | N#C/C(=C\c1cnc2cnccn12)C(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H13N5O3/c19-9-12(7-14-10-21-17-11-20-3-4-23(14)17)18(24)22-13-1-2-15-16(8-13)26-6-5-25-15/h1-4,7-8,10-11H,5-6H2,(H,22,24)/b12-7+ |
| InChIKey | BGHAMGDZIMUWRS-KPKJPENVSA-N |
| XLogP | 2.05 |
| TPSA | 101.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|