C15H25N3O4S — CID 97365289
(4aS,7R,7aR)-7-ethoxy-4-(1,3,5-trimethylpyrazol-4-yl)sulfonyl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 97365289) has the molecular formula C15H25N3O4S and a molecular weight of 343.45 g/mol. Its IUPAC name is (4aS,7R,7aR)-7-ethoxy-4-(1,3,5-trimethylpyrazol-4-yl)sulfonyl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | (4aS,7R,7aR)-7-ethoxy-4-(1,3,5-trimethylpyrazol-4-yl)sulfonyl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 97365289 |
| Molecular Formula | C15H25N3O4S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (4aS,7R,7aR)-7-ethoxy-4-(1,3,5-trimethylpyrazol-4-yl)sulfonyl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | CCO[C@@H]1CC[C@H]2[C@H]1OCCN2S(=O)(=O)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C15H25N3O4S/c1-5-21-13-7-6-12-14(13)22-9-8-18(12)23(19,20)15-10(2)16-17(4)11(15)3/h12-14H,5-9H2,1-4H3/t12-,13+,14+/m0/s1 |
| InChIKey | WIXLGVDQZKBNEE-BFHYXJOUSA-N |
| XLogP | 0.99 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |