About 1'-(furan-2-ylmethyl)-5-methylspiro[1,2-dihydroindene-3,4'-piperidine]
1'-(furan-2-ylmethyl)-5-methylspiro[1,2-dihydroindene-3,4'-piperidine] (PubChem CID 97375673) has the molecular formula C19H23NO
and a molecular weight of 281.40 g/mol. Its IUPAC name is 1'-(furan-2-ylmethyl)-5-methylspiro[1,2-dihydroindene-3,4'-piperidine].
Molecular Properties
| Compound Name | 1'-(furan-2-ylmethyl)-5-methylspiro[1,2-dihydroindene-3,4'-piperidine] |
| PubChem CID | 97375673 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 1'-(furan-2-ylmethyl)-5-methylspiro[1,2-dihydroindene-3,4'-piperidine] |
| SMILES | Cc1ccc2c(c1)C1(CC2)CCN(Cc2ccco2)CC1 |
| InChI | InChI=1S/C19H23NO/c1-15-4-5-16-6-7-19(18(16)13-15)8-10-20(11-9-19)14-17-3-2-12-21-17/h2-5,12-13H,6-11,14H2,1H3 |
| InChIKey | APTPZYBDNCQGDI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1'-(furan-2-ylmethyl)-5-methylspiro[1,2-dihydroindene-3,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-(furan-2-ylmethyl)-5-methylspiro[1,2-dihydroindene-3,4'-piperidine]?
The IUPAC name of 1'-(furan-2-ylmethyl)-5-methylspiro[1,2-dihydroindene-3,4'-piperidine] (CID 97375673) is 1'-(furan-2-ylmethyl)-5-methylspiro[1,2-dihydroindene-3,4'-piperidine].
What is the SMILES notation for 1'-(furan-2-ylmethyl)-5-methylspiro[1,2-dihydroindene-3,4'-piperidine]?
The canonical SMILES for 1'-(furan-2-ylmethyl)-5-methylspiro[1,2-dihydroindene-3,4'-piperidine] is Cc1ccc2c(c1)C1(CC2)CCN(Cc2ccco2)CC1.
What is the InChIKey of 1'-(furan-2-ylmethyl)-5-methylspiro[1,2-dihydroindene-3,4'-piperidine]?
The InChIKey is APTPZYBDNCQGDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO/c1-15-4-5-16-6-7-19(18(16)13-15)8-10-20(11-9-19)14-17-3-2-12-21-17/h2-5,12-13H,6-11,14H2,1H3.
What are the key properties of 1'-(furan-2-ylmethyl)-5-methylspiro[1,2-dihydroindene-3,4'-piperidine]?
1'-(furan-2-ylmethyl)-5-methylspiro[1,2-dihydroindene-3,4'-piperidine] has a molecular weight of 281.40 g/mol, XLogP of 4.07, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-(furan-2-ylmethyl)-5-methylspiro[1,2-dihydroindene-3,4'-piperidine] is sourced from PubChem (CID 97375673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).