C20H24N4O2 — CID 97384391
(3aR,4R,6aS)-2'-phenyl-2-(pyrrolidine-1-carbonyl)spiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-5'-one (PubChem CID 97384391) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is (3aR,4R,6aS)-2'-phenyl-2-(pyrrolidine-1-carbonyl)spiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-5'-one.
| Compound Name | (3aR,4R,6aS)-2'-phenyl-2-(pyrrolidine-1-carbonyl)spiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-5'-one |
|---|---|
| PubChem CID | 97384391 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (3aR,4R,6aS)-2'-phenyl-2-(pyrrolidine-1-carbonyl)spiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-5'-one |
| SMILES | O=C(N1CCCC1)N1C[C@H]2CC[C@@]3(N=C(c4ccccc4)NC3=O)[C@H]2C1 |
| InChI | InChI=1S/C20H24N4O2/c25-18-20(22-17(21-18)14-6-2-1-3-7-14)9-8-15-12-24(13-16(15)20)19(26)23-10-4-5-11-23/h1-3,6-7,15-16H,4-5,8-13H2,(H,21,22,25)/t15-,16+,20-/m1/s1 |
| InChIKey | AAQHKUWTXHGCQP-GQIGUUNPSA-N |
| XLogP | 1.86 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |