About 3-(imidazol-1-ylmethyl)-1-methyl-5-(1H-pyrrol-2-ylmethyl)-4,6-dihydropyrrolo[3,4-d]pyrazole
3-(imidazol-1-ylmethyl)-1-methyl-5-(1H-pyrrol-2-ylmethyl)-4,6-dihydropyrrolo[3,4-d]pyrazole (PubChem CID 97405313) has the molecular formula C15H18N6
and a molecular weight of 282.35 g/mol. Its IUPAC name is 3-(imidazol-1-ylmethyl)-1-methyl-5-(1H-pyrrol-2-ylmethyl)-4,6-dihydropyrrolo[3,4-d]pyrazole.
Molecular Properties
| Compound Name | 3-(imidazol-1-ylmethyl)-1-methyl-5-(1H-pyrrol-2-ylmethyl)-4,6-dihydropyrrolo[3,4-d]pyrazole |
| PubChem CID | 97405313 |
| Molecular Formula | C15H18N6 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 3-(imidazol-1-ylmethyl)-1-methyl-5-(1H-pyrrol-2-ylmethyl)-4,6-dihydropyrrolo[3,4-d]pyrazole |
| SMILES | Cn1nc(Cn2ccnc2)c2c1CN(Cc1ccc[nH]1)C2 |
| InChI | InChI=1S/C15H18N6/c1-19-15-10-21(7-12-3-2-4-17-12)8-13(15)14(18-19)9-20-6-5-16-11-20/h2-6,11,17H,7-10H2,1H3 |
| InChIKey | SGWVTHFAGWBYOD-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 54.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(imidazol-1-ylmethyl)-1-methyl-5-(1H-pyrrol-2-ylmethyl)-4,6-dihydropyrrolo[3,4-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(imidazol-1-ylmethyl)-1-methyl-5-(1H-pyrrol-2-ylmethyl)-4,6-dihydropyrrolo[3,4-d]pyrazole?
The IUPAC name of 3-(imidazol-1-ylmethyl)-1-methyl-5-(1H-pyrrol-2-ylmethyl)-4,6-dihydropyrrolo[3,4-d]pyrazole (CID 97405313) is 3-(imidazol-1-ylmethyl)-1-methyl-5-(1H-pyrrol-2-ylmethyl)-4,6-dihydropyrrolo[3,4-d]pyrazole.
What is the SMILES notation for 3-(imidazol-1-ylmethyl)-1-methyl-5-(1H-pyrrol-2-ylmethyl)-4,6-dihydropyrrolo[3,4-d]pyrazole?
The canonical SMILES for 3-(imidazol-1-ylmethyl)-1-methyl-5-(1H-pyrrol-2-ylmethyl)-4,6-dihydropyrrolo[3,4-d]pyrazole is Cn1nc(Cn2ccnc2)c2c1CN(Cc1ccc[nH]1)C2.
What is the InChIKey of 3-(imidazol-1-ylmethyl)-1-methyl-5-(1H-pyrrol-2-ylmethyl)-4,6-dihydropyrrolo[3,4-d]pyrazole?
The InChIKey is SGWVTHFAGWBYOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N6/c1-19-15-10-21(7-12-3-2-4-17-12)8-13(15)14(18-19)9-20-6-5-16-11-20/h2-6,11,17H,7-10H2,1H3.
What are the key properties of 3-(imidazol-1-ylmethyl)-1-methyl-5-(1H-pyrrol-2-ylmethyl)-4,6-dihydropyrrolo[3,4-d]pyrazole?
3-(imidazol-1-ylmethyl)-1-methyl-5-(1H-pyrrol-2-ylmethyl)-4,6-dihydropyrrolo[3,4-d]pyrazole has a molecular weight of 282.35 g/mol, XLogP of 1.51, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(imidazol-1-ylmethyl)-1-methyl-5-(1H-pyrrol-2-ylmethyl)-4,6-dihydropyrrolo[3,4-d]pyrazole is sourced from PubChem (CID 97405313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).