C22H22FN3O — CID 97406814
(3aR,4R,6aS)-2-[(2-fluorophenyl)methyl]-2'-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-5'-one (PubChem CID 97406814) has the molecular formula C22H22FN3O and a molecular weight of 363.44 g/mol. Its IUPAC name is (3aR,4R,6aS)-2-[(2-fluorophenyl)methyl]-2'-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-5'-one.
| Compound Name | (3aR,4R,6aS)-2-[(2-fluorophenyl)methyl]-2'-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-5'-one |
|---|---|
| PubChem CID | 97406814 |
| Molecular Formula | C22H22FN3O |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | (3aR,4R,6aS)-2-[(2-fluorophenyl)methyl]-2'-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-5'-one |
| SMILES | O=C1NC(c2ccccc2)=N[C@@]12CC[C@@H]1CN(Cc3ccccc3F)C[C@@H]12 |
| InChI | InChI=1S/C22H22FN3O/c23-19-9-5-4-8-17(19)13-26-12-16-10-11-22(18(16)14-26)21(27)24-20(25-22)15-6-2-1-3-7-15/h1-9,16,18H,10-14H2,(H,24,25,27)/t16-,18+,22-/m1/s1 |
| InChIKey | PDNAYRMQRPIXJY-TVTNDZMWSA-N |
| XLogP | 2.98 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |