C12H16N2O2 — CID 97413266
(3aS,7aR)-2-(furan-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-4-one (PubChem CID 97413266) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is (3aS,7aR)-2-(furan-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-4-one.
| Compound Name | (3aS,7aR)-2-(furan-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 97413266 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | (3aS,7aR)-2-(furan-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-4-one |
| SMILES | O=C1NCC[C@H]2CN(Cc3ccoc3)C[C@@H]12 |
| InChI | InChI=1S/C12H16N2O2/c15-12-11-7-14(5-9-2-4-16-8-9)6-10(11)1-3-13-12/h2,4,8,10-11H,1,3,5-7H2,(H,13,15)/t10-,11+/m0/s1 |
| InChIKey | QNPGOMXWJYATHN-WDEREUQCSA-N |
| XLogP | 0.85 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |