C22H31N5O4S2 — CID 97426195
(4S)-1-[(4R)-2,2-dimethyloxan-4-yl]-4-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]-6-methyl-2,4-dihydropyrazolo[3,4-d][1,3]thiazin-3-one (PubChem CID 97426195) has the molecular formula C22H31N5O4S2 and a molecular weight of 493.66 g/mol. Its IUPAC name is (4S)-1-[(4R)-2,2-dimethyloxan-4-yl]-4-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]-6-methyl-2,4-dihydropyrazolo[3,4-d][1,3]thiazin-3-one.
| Compound Name | (4S)-1-[(4R)-2,2-dimethyloxan-4-yl]-4-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]-6-methyl-2,4-dihydropyrazolo[3,4-d][1,3]thiazin-3-one |
|---|---|
| PubChem CID | 97426195 |
| Molecular Formula | C22H31N5O4S2 |
| Molecular Weight | 493.66 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | (4S)-1-[(4R)-2,2-dimethyloxan-4-yl]-4-[1-[(3S)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]-6-methyl-2,4-dihydropyrazolo[3,4-d][1,3]thiazin-3-one |
| SMILES | CC1=Nc2c(c(=O)[nH]n2[C@@H]2CCOC(C)(C)C2)[C@H](c2c(C)nn([C@H]3CCS(=O)(=O)C3)c2C)S1 |
| InChI | InChI=1S/C22H31N5O4S2/c1-12-17(13(2)26(24-12)16-7-9-33(29,30)11-16)19-18-20(23-14(3)32-19)27(25-21(18)28)15-6-8-31-22(4,5)10-15/h15-16,19H,6-11H2,1-5H3,(H,25,28)/t15-,16+,19+/m1/s1 |
| InChIKey | YSJBRVPFIZGJLO-GJYPPUQNSA-N |
| XLogP | 3.37 |
| TPSA | 111.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.66 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |