C25H28N4O4S — CID 97426769
(4R)-1-[(4S)-2,2-dimethyloxan-4-yl]-4-[3-(pyridin-3-ylmethoxy)phenyl]-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione (PubChem CID 97426769) has the molecular formula C25H28N4O4S and a molecular weight of 480.59 g/mol. Its IUPAC name is (4R)-1-[(4S)-2,2-dimethyloxan-4-yl]-4-[3-(pyridin-3-ylmethoxy)phenyl]-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione.
| Compound Name | (4R)-1-[(4S)-2,2-dimethyloxan-4-yl]-4-[3-(pyridin-3-ylmethoxy)phenyl]-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione |
|---|---|
| PubChem CID | 97426769 |
| Molecular Formula | C25H28N4O4S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | (4R)-1-[(4S)-2,2-dimethyloxan-4-yl]-4-[3-(pyridin-3-ylmethoxy)phenyl]-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione |
| SMILES | CC1(C)C[C@@H](n2[nH]c(=O)c3c2NC(=O)CS[C@@H]3c2cccc(OCc3cccnc3)c2)CCO1 |
| InChI | InChI=1S/C25H28N4O4S/c1-25(2)12-18(8-10-33-25)29-23-21(24(31)28-29)22(34-15-20(30)27-23)17-6-3-7-19(11-17)32-14-16-5-4-9-26-13-16/h3-7,9,11,13,18,22H,8,10,12,14-15H2,1-2H3,(H,27,30)(H,28,31)/t18-,22+/m0/s1 |
| InChIKey | XWLBVPUCOICEHP-PGRDOPGGSA-N |
| XLogP | 4.06 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |