C15H21N5O3S — CID 97435742
(3R)-3-cyano-N-[3-(dimethylsulfamoylamino)phenyl]piperidine-1-carboxamide (PubChem CID 97435742) has the molecular formula C15H21N5O3S and a molecular weight of 351.43 g/mol. Its IUPAC name is (3R)-3-cyano-N-[3-(dimethylsulfamoylamino)phenyl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-cyano-N-[3-(dimethylsulfamoylamino)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 97435742 |
| Molecular Formula | C15H21N5O3S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | (3R)-3-cyano-N-[3-(dimethylsulfamoylamino)phenyl]piperidine-1-carboxamide |
| SMILES | CN(C)S(=O)(=O)Nc1cccc(NC(=O)N2CCC[C@@H](C#N)C2)c1 |
| InChI | InChI=1S/C15H21N5O3S/c1-19(2)24(22,23)18-14-7-3-6-13(9-14)17-15(21)20-8-4-5-12(10-16)11-20/h3,6-7,9,12,18H,4-5,8,11H2,1-2H3,(H,17,21)/t12-/m0/s1 |
| InChIKey | XUGMLSXKCUOIMM-LBPRGKRZSA-N |
| XLogP | 1.67 |
| TPSA | 105.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |